C13H18N4O4S — CID 108875353
4-formyl-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide (PubChem CID 108875353) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-formyl-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-formyl-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108875353 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-formyl-N-[4-(methanesulfonamido)phenyl]piperazine-1-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)N2CCN(C=O)CC2)cc1 |
| InChI | InChI=1S/C13H18N4O4S/c1-22(20,21)15-12-4-2-11(3-5-12)14-13(19)17-8-6-16(10-18)7-9-17/h2-5,10,15H,6-9H2,1H3,(H,14,19) |
| InChIKey | RRKWBXSIPNTPCL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|