C13H16ClN3O4S — CID 99956126
N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 99956126) has the molecular formula C13H16ClN3O4S and a molecular weight of 345.81 g/mol. Its IUPAC name is N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 99956126 |
| Molecular Formula | C13H16ClN3O4S |
| Molecular Weight | 345.81 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[2-chloro-4-(4-formylpiperazine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)N2CCN(C=O)CC2)cc1Cl |
| InChI | InChI=1S/C13H16ClN3O4S/c1-22(20,21)15-12-3-2-10(8-11(12)14)13(19)17-6-4-16(9-18)5-7-17/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | IBCHONVOOSMBMZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.81 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|