C20H20ClN3O3 — CID 109053818
N-(3-chloro-2-methylphenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide (PubChem CID 109053818) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109053818 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cccc(C(=O)N2CCN(C=O)CC2)c1 |
| InChI | InChI=1S/C20H20ClN3O3/c1-14-17(21)6-3-7-18(14)22-19(26)15-4-2-5-16(12-15)20(27)24-10-8-23(13-25)9-11-24/h2-7,12-13H,8-11H2,1H3,(H,22,26) |
| InChIKey | KVCRYRVOUCDGMG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|