C20H22N4O3 — CID 109084687
N-(2,3-dimethylphenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 109084687) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109084687 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2cc(C(=O)N3CCN(C=O)CC3)ccn2)c1C |
| InChI | InChI=1S/C20H22N4O3/c1-14-4-3-5-17(15(14)2)22-19(26)18-12-16(6-7-21-18)20(27)24-10-8-23(13-25)9-11-24/h3-7,12-13H,8-11H2,1-2H3,(H,22,26) |
| InChIKey | ALDULFLLADOYOR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|