C18H17ClN4O3 — CID 109084701
N-(2-chlorophenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 109084701) has the molecular formula C18H17ClN4O3 and a molecular weight of 372.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-(2-chlorophenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109084701 |
| Molecular Formula | C18H17ClN4O3 |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-(2-chlorophenyl)-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | O=CN1CCN(C(=O)c2ccnc(C(=O)Nc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C18H17ClN4O3/c19-14-3-1-2-4-15(14)21-17(25)16-11-13(5-6-20-16)18(26)23-9-7-22(12-24)8-10-23/h1-6,11-12H,7-10H2,(H,21,25) |
| InChIKey | XODWFVSNLLIGGW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|