C20H23N5O3 — CID 109084727
N-[4-(dimethylamino)phenyl]-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 109084727) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[4-(dimethylamino)phenyl]-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-[4-(dimethylamino)phenyl]-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109084727 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-[4-(dimethylamino)phenyl]-4-(4-formylpiperazine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(C(=O)N3CCN(C=O)CC3)ccn2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-23(2)17-5-3-16(4-6-17)22-19(27)18-13-15(7-8-21-18)20(28)25-11-9-24(14-26)10-12-25/h3-8,13-14H,9-12H2,1-2H3,(H,22,27) |
| InChIKey | ZQTUGHPRKHXQBJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|