C23H22N4O2 — CID 109091571
4-(2,3-dihydroindole-1-carbonyl)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide (PubChem CID 109091571) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-(2,3-dihydroindole-1-carbonyl)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide.
| Compound Name | 4-(2,3-dihydroindole-1-carbonyl)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109091571 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-(2,3-dihydroindole-1-carbonyl)-N-[4-(dimethylamino)phenyl]pyridine-2-carboxamide |
| SMILES | CN(C)c1ccc(NC(=O)c2cc(C(=O)N3CCc4ccccc43)ccn2)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-26(2)19-9-7-18(8-10-19)25-22(28)20-15-17(11-13-24-20)23(29)27-14-12-16-5-3-4-6-21(16)27/h3-11,13,15H,12,14H2,1-2H3,(H,25,28) |
| InChIKey | DCDOLNUJZVPKDK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|