C19H18FN3O3 — CID 109053814
N-(4-fluorophenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide (PubChem CID 109053814) has the molecular formula C19H18FN3O3 and a molecular weight of 355.37 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide.
| Compound Name | N-(4-fluorophenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109053814 |
| Molecular Formula | C19H18FN3O3 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-(4-fluorophenyl)-3-(4-formylpiperazine-1-carbonyl)benzamide |
| SMILES | O=CN1CCN(C(=O)c2cccc(C(=O)Nc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C19H18FN3O3/c20-16-4-6-17(7-5-16)21-18(25)14-2-1-3-15(12-14)19(26)23-10-8-22(13-24)9-11-23/h1-7,12-13H,8-11H2,(H,21,25) |
| InChIKey | FXVWQOYGYNQLBR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|