C23H19ClN2O2 — CID 109057097
N-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindole-1-carbonyl)benzamide (PubChem CID 109057097) has the molecular formula C23H19ClN2O2 and a molecular weight of 390.87 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindole-1-carbonyl)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindole-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109057097 |
| Molecular Formula | C23H19ClN2O2 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-3-(2,3-dihydroindole-1-carbonyl)benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cccc(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C23H19ClN2O2/c1-15-19(24)9-5-10-20(15)25-22(27)17-7-4-8-18(14-17)23(28)26-13-12-16-6-2-3-11-21(16)26/h2-11,14H,12-13H2,1H3,(H,25,27) |
| InChIKey | DJAPMVHPXRIZNW-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |