C24H22N2O2 — CID 109049527
4-(2,3-dihydroindole-1-carbonyl)-N-(2,4-dimethylphenyl)benzamide (PubChem CID 109049527) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-(2,3-dihydroindole-1-carbonyl)-N-(2,4-dimethylphenyl)benzamide.
| Compound Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(2,4-dimethylphenyl)benzamide |
|---|---|
| PubChem CID | 109049527 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(2,4-dimethylphenyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(C(=O)N3CCc4ccccc43)cc2)c(C)c1 |
| InChI | InChI=1S/C24H22N2O2/c1-16-7-12-21(17(2)15-16)25-23(27)19-8-10-20(11-9-19)24(28)26-14-13-18-5-3-4-6-22(18)26/h3-12,15H,13-14H2,1-2H3,(H,25,27) |
| InChIKey | RUJOJHOZFLKKTJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |