C22H16F2N2O2 — CID 109049570
N-(3,4-difluorophenyl)-4-(2,3-dihydroindole-1-carbonyl)benzamide (PubChem CID 109049570) has the molecular formula C22H16F2N2O2 and a molecular weight of 378.38 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4-(2,3-dihydroindole-1-carbonyl)benzamide.
| Compound Name | N-(3,4-difluorophenyl)-4-(2,3-dihydroindole-1-carbonyl)benzamide |
|---|---|
| PubChem CID | 109049570 |
| Molecular Formula | C22H16F2N2O2 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-4-(2,3-dihydroindole-1-carbonyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H16F2N2O2/c23-18-10-9-17(13-19(18)24)25-21(27)15-5-7-16(8-6-15)22(28)26-12-11-14-3-1-2-4-20(14)26/h1-10,13H,11-12H2,(H,25,27) |
| InChIKey | OASUQTITSOYKGK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |