C22H17FN2O2 — CID 109049539
4-(2,3-dihydroindole-1-carbonyl)-N-(4-fluorophenyl)benzamide (PubChem CID 109049539) has the molecular formula C22H17FN2O2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-(2,3-dihydroindole-1-carbonyl)-N-(4-fluorophenyl)benzamide.
| Compound Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 109049539 |
| Molecular Formula | C22H17FN2O2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H17FN2O2/c23-18-9-11-19(12-10-18)24-21(26)16-5-7-17(8-6-16)22(27)25-14-13-15-3-1-2-4-20(15)25/h1-12H,13-14H2,(H,24,26) |
| InChIKey | NURWGUNLVYMQMO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |