C22H15F3N2O2 — CID 109049568
4-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 109049568) has the molecular formula C22H15F3N2O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is 4-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 109049568 |
| Molecular Formula | C22H15F3N2O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 4-(2,3-dihydroindole-1-carbonyl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1ccc(C(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H15F3N2O2/c23-16-9-10-17(20(25)19(16)24)26-21(28)14-5-7-15(8-6-14)22(29)27-12-11-13-3-1-2-4-18(13)27/h1-10H,11-12H2,(H,26,28) |
| InChIKey | QBMBWMMIUHYUAR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|