C16H14FNO — CID 17476941
2,3-dihydroindol-1-yl-(3-fluoro-4-methylphenyl)methanone (PubChem CID 17476941) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(3-fluoro-4-methylphenyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(3-fluoro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 17476941 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(3-fluoro-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCc3ccccc32)cc1F |
| InChI | InChI=1S/C16H14FNO/c1-11-6-7-13(10-14(11)17)16(19)18-9-8-12-4-2-3-5-15(12)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | ZFPFCCIIVOILDZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |