C16H14BrNO2 — CID 675985
(3-bromo-4-methoxyphenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 675985) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3-bromo-4-methoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 675985 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCc3ccccc32)cc1Br |
| InChI | InChI=1S/C16H14BrNO2/c1-20-15-7-6-12(10-13(15)17)16(19)18-9-8-11-4-2-3-5-14(11)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | DFZLIWNEWKHSFE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |