C19H20BrNO2 — CID 4955762
(3-bromo-4-butoxyphenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 4955762) has the molecular formula C19H20BrNO2 and a molecular weight of 374.28 g/mol. Its IUPAC name is (3-bromo-4-butoxyphenyl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (3-bromo-4-butoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 4955762 |
| Molecular Formula | C19H20BrNO2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (3-bromo-4-butoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | CCCCOc1ccc(C(=O)N2CCc3ccccc32)cc1Br |
| InChI | InChI=1S/C19H20BrNO2/c1-2-3-12-23-18-9-8-15(13-16(18)20)19(22)21-11-10-14-6-4-5-7-17(14)21/h4-9,13H,2-3,10-12H2,1H3 |
| InChIKey | STSSSDJFBVBUHI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|