C22H25BrN2O2S — CID 4959758
3-bromo-N-(2,3-dihydroindole-1-carbothioyl)-4-hexoxybenzamide (PubChem CID 4959758) has the molecular formula C22H25BrN2O2S and a molecular weight of 461.43 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydroindole-1-carbothioyl)-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-(2,3-dihydroindole-1-carbothioyl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959758 |
| Molecular Formula | C22H25BrN2O2S |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 3-bromo-N-(2,3-dihydroindole-1-carbothioyl)-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)N2CCc3ccccc32)cc1Br |
| InChI | InChI=1S/C22H25BrN2O2S/c1-2-3-4-7-14-27-20-11-10-17(15-18(20)23)21(26)24-22(28)25-13-12-16-8-5-6-9-19(16)25/h5-6,8-11,15H,2-4,7,12-14H2,1H3,(H,24,26,28) |
| InChIKey | VNAYJYLCDBKKDJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|