C18H16N2O3S — CID 17178494
methyl 4-(2,3-dihydroindole-1-carbothioylcarbamoyl)benzoate (PubChem CID 17178494) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 4-(2,3-dihydroindole-1-carbothioylcarbamoyl)benzoate.
| Compound Name | methyl 4-(2,3-dihydroindole-1-carbothioylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 17178494 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | methyl 4-(2,3-dihydroindole-1-carbothioylcarbamoyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H16N2O3S/c1-23-17(22)14-8-6-13(7-9-14)16(21)19-18(24)20-11-10-12-4-2-3-5-15(12)20/h2-9H,10-11H2,1H3,(H,19,21,24) |
| InChIKey | QPAOEEFXFAPVRA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|