C16H13N3O3S — CID 916839
N-(2,3-dihydroindole-1-carbothioyl)-3-nitrobenzamide (PubChem CID 916839) has the molecular formula C16H13N3O3S and a molecular weight of 327.37 g/mol. Its IUPAC name is N-(2,3-dihydroindole-1-carbothioyl)-3-nitrobenzamide.
| Compound Name | N-(2,3-dihydroindole-1-carbothioyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 916839 |
| Molecular Formula | C16H13N3O3S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-(2,3-dihydroindole-1-carbothioyl)-3-nitrobenzamide |
| SMILES | O=C(NC(=S)N1CCc2ccccc21)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N3O3S/c20-15(12-5-3-6-13(10-12)19(21)22)17-16(23)18-9-8-11-4-1-2-7-14(11)18/h1-7,10H,8-9H2,(H,17,20,23) |
| InChIKey | HTMJBFGKJZRSRI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|