C16H15N3O2S — CID 19686745
N-(3-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 19686745) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(3-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-(3-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 19686745 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | N-(3-nitrophenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | O=[N+]([O-])c1cccc(NC(=S)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C16H15N3O2S/c20-19(21)14-8-3-7-13(11-14)17-16(22)18-10-4-6-12-5-1-2-9-15(12)18/h1-3,5,7-9,11H,4,6,10H2,(H,17,22) |
| InChIKey | OCJKIRASAZPTGJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|