C18H20N2S — CID 71821627
N-(3-ethylphenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 71821627) has the molecular formula C18H20N2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-(3-ethylphenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-(3-ethylphenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 71821627 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-(3-ethylphenyl)-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | CCc1cccc(NC(=S)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2S/c1-2-14-7-5-10-16(13-14)19-18(21)20-12-6-9-15-8-3-4-11-17(15)20/h3-5,7-8,10-11,13H,2,6,9,12H2,1H3,(H,19,21) |
| InChIKey | RGXNNJFXJMCNNC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|