C12H16N2S — CID 4778898
N-ethyl-3,4-dihydro-2H-quinoline-1-carbothioamide (PubChem CID 4778898) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N-ethyl-3,4-dihydro-2H-quinoline-1-carbothioamide.
| Compound Name | N-ethyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
|---|---|
| PubChem CID | 4778898 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-ethyl-3,4-dihydro-2H-quinoline-1-carbothioamide |
| SMILES | CCNC(=S)N1CCCc2ccccc21 |
| InChI | InChI=1S/C12H16N2S/c1-2-13-12(15)14-9-5-7-10-6-3-4-8-11(10)14/h3-4,6,8H,2,5,7,9H2,1H3,(H,13,15) |
| InChIKey | LLVDMYARJDGYDC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|