C20H20N2NiS4 — CID 6100591
bis(3,4-dihydro-2H-quinoline-1-carbodithioate);nickel(2+) (PubChem CID 6100591) has the molecular formula C20H20N2NiS4 and a molecular weight of 475.36 g/mol. Its IUPAC name is bis(3,4-dihydro-2H-quinoline-1-carbodithioate);nickel(2+).
| Compound Name | bis(3,4-dihydro-2H-quinoline-1-carbodithioate);nickel(2+) |
|---|---|
| PubChem CID | 6100591 |
| Molecular Formula | C20H20N2NiS4 |
| Molecular Weight | 475.36 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | bis(3,4-dihydro-2H-quinoline-1-carbodithioate);nickel(2+) |
| SMILES | S=C([S-])N1CCCc2ccccc21.S=C([S-])N1CCCc2ccccc21.[Ni+2] |
| InChI | InChI=1S/2C10H11NS2.Ni/c2*12-10(13)11-7-3-5-8-4-1-2-6-9(8)11;/h2*1-2,4,6H,3,5,7H2,(H,12,13);/q;;+2/p-2 |
| InChIKey | MOEIHEFREUMTJQ-UHFFFAOYSA-L |
| XLogP | 4.54 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|