C18H19NO2S — CID 123099535
2-benzylsulfinyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 123099535) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is 2-benzylsulfinyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-benzylsulfinyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 123099535 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-benzylsulfinyl-1-(3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(CS(=O)Cc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C18H19NO2S/c20-18(14-22(21)13-15-7-2-1-3-8-15)19-12-6-10-16-9-4-5-11-17(16)19/h1-5,7-9,11H,6,10,12-14H2 |
| InChIKey | BNVDPUGCTLSWNF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |