C17H17NOS — CID 3476595
1-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylsulfanylethanone (PubChem CID 3476595) has the molecular formula C17H17NOS and a molecular weight of 283.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylsulfanylethanone.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylsulfanylethanone |
|---|---|
| PubChem CID | 3476595 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-phenylsulfanylethanone |
| SMILES | O=C(CSc1ccccc1)N1CCCc2ccccc21 |
| InChI | InChI=1S/C17H17NOS/c19-17(13-20-15-9-2-1-3-10-15)18-12-6-8-14-7-4-5-11-16(14)18/h1-5,7,9-11H,6,8,12-13H2 |
| InChIKey | MROKVWIEMREAJC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |