C24H21N3O4S — CID 22782103
N-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 22782103) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 22782103 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[4-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc(SCC(=O)N2CCCc3ccccc32)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H21N3O4S/c28-23(26-15-3-5-17-4-1-2-6-22(17)26)16-32-21-13-9-19(10-14-21)25-24(29)18-7-11-20(12-8-18)27(30)31/h1-2,4,6-14H,3,5,15-16H2,(H,25,29) |
| InChIKey | PJIUHLCJIYKYLZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|