C18H17N3O4S — CID 27355024
N-[4-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylphenyl]acetamide (PubChem CID 27355024) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is N-[4-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 27355024 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-[4-[2-(5-nitro-2,3-dihydroindol-1-yl)-2-oxoethyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SCC(=O)N2CCc3cc([N+](=O)[O-])ccc32)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-12(22)19-14-2-5-16(6-3-14)26-11-18(23)20-9-8-13-10-15(21(24)25)4-7-17(13)20/h2-7,10H,8-9,11H2,1H3,(H,19,22) |
| InChIKey | RUBHNOKBCUAKCD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|