C11H11ClN2O3 — CID 2782274
3-chloro-1-(5-nitro-2,3-dihydroindol-1-yl)propan-1-one (PubChem CID 2782274) has the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. Its IUPAC name is 3-chloro-1-(5-nitro-2,3-dihydroindol-1-yl)propan-1-one.
| Compound Name | 3-chloro-1-(5-nitro-2,3-dihydroindol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 2782274 |
| Molecular Formula | C11H11ClN2O3 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-chloro-1-(5-nitro-2,3-dihydroindol-1-yl)propan-1-one |
| SMILES | O=C(CCCl)N1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C11H11ClN2O3/c12-5-3-11(15)13-6-4-8-7-9(14(16)17)1-2-10(8)13/h1-2,7H,3-6H2 |
| InChIKey | ZXNPPIQKYURSQG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|