C13H15N3O5 — CID 155928165
(2S)-2-amino-5-(5-nitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid (PubChem CID 155928165) has the molecular formula C13H15N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is (2S)-2-amino-5-(5-nitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(5-nitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 155928165 |
| Molecular Formula | C13H15N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | (2S)-2-amino-5-(5-nitro-2,3-dihydroindol-1-yl)-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N1CCc2cc([N+](=O)[O-])ccc21)C(=O)O |
| InChI | InChI=1S/C13H15N3O5/c14-10(13(18)19)2-4-12(17)15-6-5-8-7-9(16(20)21)1-3-11(8)15/h1,3,7,10H,2,4-6,14H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | UDSRSYBPZGERNL-JTQLQIEISA-N |
| XLogP | 0.68 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|