4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid

C12H10N2O5 — CID 4044459

IUPAC4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)N1CCc2cc([N+](=O)[O-])ccc21
InChIInChI=1S/C12H10N2O5/c15-11(3-4-12(16)17)13-6-5-8-7-9(14(18)19)1-2-10(8)13/h1-4,7H,5-6H2,(H,16,17)
InChIKeyJZQYDPYEEGTBNL-UHFFFAOYSA-N
MW262.22 g/mol
LogP1.12
Rot. Bonds3

About 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid

4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid (PubChem CID 4044459) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid.

Molecular Properties

Compound Name4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid
PubChem CID4044459
Molecular FormulaC12H10N2O5
Molecular Weight262.22 g/mol
Exact Mass262.06
IUPAC Name4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid
SMILESO=C(O)C=CC(=O)N1CCc2cc([N+](=O)[O-])ccc21
InChIInChI=1S/C12H10N2O5/c15-11(3-4-12(16)17)13-6-5-8-7-9(14(18)19)1-2-10(8)13/h1-4,7H,5-6H2,(H,16,17)
InChIKeyJZQYDPYEEGTBNL-UHFFFAOYSA-N
XLogP1.12
TPSA100.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.22
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid?
The IUPAC name of 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid (CID 4044459) is 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid is O=C(O)C=CC(=O)N1CCc2cc([N+](=O)[O-])ccc21.
What is the InChIKey of 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid?
The InChIKey is JZQYDPYEEGTBNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O5/c15-11(3-4-12(16)17)13-6-5-8-7-9(14(18)19)1-2-10(8)13/h1-4,7H,5-6H2,(H,16,17).
What are the key properties of 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid?
4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid has a molecular weight of 262.22 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 4044459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).