C12H10N2O5 — CID 4044459
4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid (PubChem CID 4044459) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid.
| Compound Name | 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 4044459 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-(5-nitro-2,3-dihydroindol-1-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)N1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H10N2O5/c15-11(3-4-12(16)17)13-6-5-8-7-9(14(18)19)1-2-10(8)13/h1-4,7H,5-6H2,(H,16,17) |
| InChIKey | JZQYDPYEEGTBNL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|