C16H11N2O5- — CID 7155300
2-(5-nitro-2,3-dihydroindole-1-carbonyl)benzoate (PubChem CID 7155300) has the molecular formula C16H11N2O5- and a molecular weight of 311.27 g/mol. Its IUPAC name is 2-(5-nitro-2,3-dihydroindole-1-carbonyl)benzoate.
| Compound Name | 2-(5-nitro-2,3-dihydroindole-1-carbonyl)benzoate |
|---|---|
| PubChem CID | 7155300 |
| Molecular Formula | C16H11N2O5- |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(5-nitro-2,3-dihydroindole-1-carbonyl)benzoate |
| SMILES | O=C([O-])c1ccccc1C(=O)N1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C16H12N2O5/c19-15(12-3-1-2-4-13(12)16(20)21)17-8-7-10-9-11(18(22)23)5-6-14(10)17/h1-6,9H,7-8H2,(H,20,21)/p-1 |
| InChIKey | YHNUCHAQARUEEH-UHFFFAOYSA-M |
| XLogP | 1.16 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|