C23H22N4O3 — CID 55772974
(5-nitro-2,3-dihydroindol-1-yl)-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone (PubChem CID 55772974) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is (5-nitro-2,3-dihydroindol-1-yl)-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone.
| Compound Name | (5-nitro-2,3-dihydroindol-1-yl)-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 55772974 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (5-nitro-2,3-dihydroindol-1-yl)-(1-phenyl-5,6,7,8-tetrahydro-4H-cyclohepta[d]pyrazol-3-yl)methanone |
| SMILES | O=C(c1nn(-c2ccccc2)c2c1CCCCC2)N1CCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H22N4O3/c28-23(25-14-13-16-15-18(27(29)30)11-12-20(16)25)22-19-9-5-2-6-10-21(19)26(24-22)17-7-3-1-4-8-17/h1,3-4,7-8,11-12,15H,2,5-6,9-10,13-14H2 |
| InChIKey | DVBRQXNJKRLCGP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|