C13H13N3O2 — CID 139801411
3-nitro-1-phenyl-4,5,6,7-tetrahydroindazole (PubChem CID 139801411) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-nitro-1-phenyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-nitro-1-phenyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 139801411 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-nitro-1-phenyl-4,5,6,7-tetrahydroindazole |
| SMILES | O=[N+]([O-])c1nn(-c2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C13H13N3O2/c17-16(18)13-11-8-4-5-9-12(11)15(14-13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | CSBMEXRUCCXCAX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|