C18H24N2 — CID 102460361
3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole (PubChem CID 102460361) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 102460361 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole |
| SMILES | CCCCCc1nn(-c2ccccc2)c2c1CCCC2 |
| InChI | InChI=1S/C18H24N2/c1-2-3-5-13-17-16-12-8-9-14-18(16)20(19-17)15-10-6-4-7-11-15/h4,6-7,10-11H,2-3,5,8-9,12-14H2,1H3 |
| InChIKey | VISPEYDPJFXQDG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|