C19H26N2 — CID 139238262
5-methyl-3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole (PubChem CID 139238262) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 5-methyl-3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 5-methyl-3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 139238262 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 5-methyl-3-pentyl-1-phenyl-4,5,6,7-tetrahydroindazole |
| SMILES | CCCCCc1nn(-c2ccccc2)c2c1CC(C)CC2 |
| InChI | InChI=1S/C19H26N2/c1-3-4-6-11-18-17-14-15(2)12-13-19(17)21(20-18)16-9-7-5-8-10-16/h5,7-10,15H,3-4,6,11-14H2,1-2H3 |
| InChIKey | MTECQZWJEZWDBS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|