C13H24 — CID 175171026
1,4-dimethyl-2-pentylcyclohexene (PubChem CID 175171026) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 1,4-dimethyl-2-pentylcyclohexene.
| Compound Name | 1,4-dimethyl-2-pentylcyclohexene |
|---|---|
| PubChem CID | 175171026 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 1,4-dimethyl-2-pentylcyclohexene |
| SMILES | CCCCCC1=C(C)CCC(C)C1 |
| InChI | InChI=1S/C13H24/c1-4-5-6-7-13-10-11(2)8-9-12(13)3/h11H,4-10H2,1-3H3 |
| InChIKey | XTXHCOHZHRWIKR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|