C20H36 — CID 101427579
1,6-dihexyl-2-methylcyclohepta-1,4-diene (PubChem CID 101427579) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 1,6-dihexyl-2-methylcyclohepta-1,4-diene.
| Compound Name | 1,6-dihexyl-2-methylcyclohepta-1,4-diene |
|---|---|
| PubChem CID | 101427579 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 1,6-dihexyl-2-methylcyclohepta-1,4-diene |
| SMILES | CCCCCCC1=C(C)CC=CC(CCCCCC)C1 |
| InChI | InChI=1S/C20H36/c1-4-6-8-10-14-19-15-12-13-18(3)20(17-19)16-11-9-7-5-2/h12,15,19H,4-11,13-14,16-17H2,1-3H3 |
| InChIKey | MCKCQIWHIYJDOW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|