About 1,2-diheptylcyclopropene
1,2-diheptylcyclopropene (PubChem CID 557048) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 1,2-diheptylcyclopropene.
Molecular Properties
| Compound Name | 1,2-diheptylcyclopropene |
| PubChem CID | 557048 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 1,2-diheptylcyclopropene |
| SMILES | CCCCCCCC1=C(CCCCCCC)C1 |
| InChI | InChI=1S/C17H32/c1-3-5-7-9-11-13-16-15-17(16)14-12-10-8-6-4-2/h3-15H2,1-2H3 |
| InChIKey | JMXZTHUSPYEWKJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diheptylcyclopropene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diheptylcyclopropene?
The IUPAC name of 1,2-diheptylcyclopropene (CID 557048) is 1,2-diheptylcyclopropene.
What is the SMILES notation for 1,2-diheptylcyclopropene?
The canonical SMILES for 1,2-diheptylcyclopropene is CCCCCCCC1=C(CCCCCCC)C1.
What is the InChIKey of 1,2-diheptylcyclopropene?
The InChIKey is JMXZTHUSPYEWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-3-5-7-9-11-13-16-15-17(16)14-12-10-8-6-4-2/h3-15H2,1-2H3.
What are the key properties of 1,2-diheptylcyclopropene?
1,2-diheptylcyclopropene has a molecular weight of 236.44 g/mol, XLogP of 6.41, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diheptylcyclopropene is sourced from PubChem (CID 557048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).