C19H34O2 — CID 175795883
1-decyl-4,5-dimethoxy-2-methylcyclohexa-1,4-diene (PubChem CID 175795883) has the molecular formula C19H34O2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 1-decyl-4,5-dimethoxy-2-methylcyclohexa-1,4-diene.
| Compound Name | 1-decyl-4,5-dimethoxy-2-methylcyclohexa-1,4-diene |
|---|---|
| PubChem CID | 175795883 |
| Molecular Formula | C19H34O2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.26 |
| IUPAC Name | 1-decyl-4,5-dimethoxy-2-methylcyclohexa-1,4-diene |
| SMILES | CCCCCCCCCCC1=C(C)CC(OC)=C(OC)C1 |
| InChI | InChI=1S/C19H34O2/c1-5-6-7-8-9-10-11-12-13-17-15-19(21-4)18(20-3)14-16(17)2/h5-15H2,1-4H3 |
| InChIKey | ZUCPQKUFNLHNFK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|