About (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane
(4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane (PubChem CID 144561487) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane.
Molecular Properties
| Compound Name | (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane |
| PubChem CID | 144561487 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane |
| SMILES | C/C=C1/CC(C)=C(CCC)C1.CCC.CCCCCCC |
| InChI | InChI=1S/C11H18.C7H16.C3H8/c1-4-6-11-8-10(5-2)7-9(11)3;1-3-5-7-6-4-2;1-3-2/h5H,4,6-8H2,1-3H3;3-7H2,1-2H3;3H2,1-2H3/b10-5-;; |
| InChIKey | MEIWAILXUOGJIH-KGEBAWAISA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane?
The IUPAC name of (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane (CID 144561487) is (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane.
What is the SMILES notation for (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane?
The canonical SMILES for (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane is C/C=C1/CC(C)=C(CCC)C1.CCC.CCCCCCC.
What is the InChIKey of (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane?
The InChIKey is MEIWAILXUOGJIH-KGEBAWAISA-N. The full InChI is InChI=1S/C11H18.C7H16.C3H8/c1-4-6-11-8-10(5-2)7-9(11)3;1-3-5-7-6-4-2;1-3-2/h5H,4,6-8H2,1-3H3;3-7H2,1-2H3;3H2,1-2H3/b10-5-;;.
What are the key properties of (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane?
(4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane has a molecular weight of 294.57 g/mol, XLogP of 8.24, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethylidene-1-methyl-2-propylcyclopentene;heptane;propane is sourced from PubChem (CID 144561487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).