C20H21N3O3 — CID 4876796
2,3-dihydroindol-1-yl-(5-nitro-2-piperidin-1-ylphenyl)methanone (PubChem CID 4876796) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-(5-nitro-2-piperidin-1-ylphenyl)methanone.
| Compound Name | 2,3-dihydroindol-1-yl-(5-nitro-2-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 4876796 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2,3-dihydroindol-1-yl-(5-nitro-2-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1N1CCCCC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C20H21N3O3/c24-20(22-13-10-15-6-2-3-7-18(15)22)17-14-16(23(25)26)8-9-19(17)21-11-4-1-5-12-21/h2-3,6-9,14H,1,4-5,10-13H2 |
| InChIKey | STTBDSZTRDAOTP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|