C20H20N4O5 — CID 16582546
(6-nitro-2,3-dihydroindol-1-yl)-(3-nitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 16582546) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is (6-nitro-2,3-dihydroindol-1-yl)-(3-nitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | (6-nitro-2,3-dihydroindol-1-yl)-(3-nitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 16582546 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (6-nitro-2,3-dihydroindol-1-yl)-(3-nitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | O=C(c1ccc(N2CCCCC2)c([N+](=O)[O-])c1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C20H20N4O5/c25-20(22-11-8-14-4-6-16(23(26)27)13-18(14)22)15-5-7-17(19(12-15)24(28)29)21-9-2-1-3-10-21/h4-7,12-13H,1-3,8-11H2 |
| InChIKey | PVLUNUHEBUBRDM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|