C16H14N2O3 — CID 110291906
(7-nitro-3,4-dihydro-2H-quinolin-1-yl)-phenylmethanone (PubChem CID 110291906) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is (7-nitro-3,4-dihydro-2H-quinolin-1-yl)-phenylmethanone.
| Compound Name | (7-nitro-3,4-dihydro-2H-quinolin-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 110291906 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | (7-nitro-3,4-dihydro-2H-quinolin-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C16H14N2O3/c19-16(13-5-2-1-3-6-13)17-10-4-7-12-8-9-14(18(20)21)11-15(12)17/h1-3,5-6,8-9,11H,4,7,10H2 |
| InChIKey | FJOFUURWIAQKAO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|