C23H19N3O4 — CID 16835048
N-(1-benzoyl-3,4-dihydro-2H-quinolin-7-yl)-4-nitrobenzamide (PubChem CID 16835048) has the molecular formula C23H19N3O4 and a molecular weight of 401.42 g/mol. Its IUPAC name is N-(1-benzoyl-3,4-dihydro-2H-quinolin-7-yl)-4-nitrobenzamide.
| Compound Name | N-(1-benzoyl-3,4-dihydro-2H-quinolin-7-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 16835048 |
| Molecular Formula | C23H19N3O4 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-(1-benzoyl-3,4-dihydro-2H-quinolin-7-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)N(C(=O)c1ccccc1)CCC2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19N3O4/c27-22(17-9-12-20(13-10-17)26(29)30)24-19-11-8-16-7-4-14-25(21(16)15-19)23(28)18-5-2-1-3-6-18/h1-3,5-6,8-13,15H,4,7,14H2,(H,24,27) |
| InChIKey | PHVSJQJGHSJEHN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|