C29H24N2O2 — CID 121084310
N-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-4-phenylbenzamide (PubChem CID 121084310) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is N-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-4-phenylbenzamide.
| Compound Name | N-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 121084310 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | N-(1-benzoyl-3,4-dihydro-2H-quinolin-6-yl)-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CCCN2C(=O)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24N2O2/c32-28(23-15-13-22(14-16-23)21-8-3-1-4-9-21)30-26-17-18-27-25(20-26)12-7-19-31(27)29(33)24-10-5-2-6-11-24/h1-6,8-11,13-18,20H,7,12,19H2,(H,30,32) |
| InChIKey | KOXNUKQDSBGUNH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |