C16H14N2O3 — CID 23147979
5-benzamido-2,3-dihydroindole-1-carboxylic acid (PubChem CID 23147979) has the molecular formula C16H14N2O3 and a molecular weight of 282.30 g/mol. Its IUPAC name is 5-benzamido-2,3-dihydroindole-1-carboxylic acid.
| Compound Name | 5-benzamido-2,3-dihydroindole-1-carboxylic acid |
|---|---|
| PubChem CID | 23147979 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-benzamido-2,3-dihydroindole-1-carboxylic acid |
| SMILES | O=C(Nc1ccc2c(c1)CCN2C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O3/c19-15(11-4-2-1-3-5-11)17-13-6-7-14-12(10-13)8-9-18(14)16(20)21/h1-7,10H,8-9H2,(H,17,19)(H,20,21) |
| InChIKey | AYHNENKQFOPVRD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |