C18H19N3O2 — CID 110744715
N-[2-[(1-methyl-2,3-dihydroindol-5-yl)amino]-2-oxoethyl]benzamide (PubChem CID 110744715) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[2-[(1-methyl-2,3-dihydroindol-5-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[(1-methyl-2,3-dihydroindol-5-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110744715 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-[2-[(1-methyl-2,3-dihydroindol-5-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CN1CCc2cc(NC(=O)CNC(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C18H19N3O2/c1-21-10-9-14-11-15(7-8-16(14)21)20-17(22)12-19-18(23)13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | WRTROZAYWFIGNS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|