C23H21N3O3 — CID 60518009
N-[2-(5-benzamido-2-methylanilino)-2-oxoethyl]benzamide (PubChem CID 60518009) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[2-(5-benzamido-2-methylanilino)-2-oxoethyl]benzamide.
| Compound Name | N-[2-(5-benzamido-2-methylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 60518009 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[2-(5-benzamido-2-methylanilino)-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccccc2)cc1NC(=O)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O3/c1-16-12-13-19(25-23(29)18-10-6-3-7-11-18)14-20(16)26-21(27)15-24-22(28)17-8-4-2-5-9-17/h2-14H,15H2,1H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | GDSOILVUYSQTQU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |