C19H22N4O3 — CID 86994865
N-[3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-methylphenyl]benzamide (PubChem CID 86994865) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-methylphenyl]benzamide.
| Compound Name | N-[3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 86994865 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[3-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]-4-methylphenyl]benzamide |
| SMILES | CCNC(=O)CNC(=O)Nc1cc(NC(=O)c2ccccc2)ccc1C |
| InChI | InChI=1S/C19H22N4O3/c1-3-20-17(24)12-21-19(26)23-16-11-15(10-9-13(16)2)22-18(25)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,20,24)(H,22,25)(H2,21,23,26) |
| InChIKey | BOHPUVMFZMAEDZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |