C23H21N3O2 — CID 54839150
N-[3-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]phenyl]benzamide (PubChem CID 54839150) has the molecular formula C23H21N3O2 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[3-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 54839150 |
| Molecular Formula | C23H21N3O2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[3-[[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]amino]phenyl]benzamide |
| SMILES | O=C(Nc1cccc(NCC(=O)N2CCc3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O2/c27-22(26-14-13-17-7-4-5-12-21(17)26)16-24-19-10-6-11-20(15-19)25-23(28)18-8-2-1-3-9-18/h1-12,15,24H,13-14,16H2,(H,25,28) |
| InChIKey | MCICEAARCWWTPE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |